| Identification | |
| Name: | 2,1,3-Benzothiadiazole |
| Synonyms: | 2-Thia-1,3-diaza-2H-isoindene;3,4-Benzo-1,2,5-thiadiazole;Benzisothiadiazole;Benzo[1,2,5]thiadiazole;NSC43636;NSC 679; |
| CAS: | 273-13-2 |
| EINECS: | 205-985-2 |
| Molecular Formula: | C6H4N2S |
| Molecular Weight: | 136.17 |
| InChI: | InChI=1/C6H4N2S/c1-2-4-6-5(3-1)7-9-8-6/h1-4H |
| Molecular Structure: | ![(C6H4N2S) 2-Thia-1,3-diaza-2H-isoindene;3,4-Benzo-1,2,5-thiadiazole;Benzisothiadiazole;Benzo[1,2,5]thiadiazole...](https://img.guidechem.com/casimg/273-13-2.gif) |
| Properties | |
| Transport: | OTH |
| Flash Point: | 203? |
| Density: | 1.368 g/cm3 |
| Refractive index: | 1.705 |
| Solubility: | Appearance:white to off-white crystalline powder Transport Information: OTH Hazard Symbols:UN NO. Safety:S24/25 |
| Appearance: | white to off-white crystalline powder |
| Flash Point: | 203? |
| Safety Data | |
| Hazard Symbols | |
 |
|
