| Identification | |
| Name: | 1,3-Benzodioxole |
| Synonyms: | 1,2-(Methylenedioxy)benzene; 1,3-Dioxaindane; 1,3-Benzodioxole,(1,2-Methylenedioxybenzene); 1,3-benzodioxolane; 1,3-Benzodioxol; 1,2-Methylene Dioxy Benzene; Pepper rings; 1,2-Benzodioxole |
| CAS: | 274-09-9 |
| EINECS: | 205-992-0 |
| Molecular Formula: | C7H6O2 |
| Molecular Weight: | 122.12 |
| InChI: | InChI=1/C7H6O2/c1-2-4-7-6(3-1)8-5-9-7/h1-4H,5H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Density: | 1.06 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.538-1.54 |
| Solubility: | 0.2 g/100 mL (25 oC) |
| Appearance: | clear colourless to light yellow liquid |
| Specification: |
? 1,2-Methylenedioxybenzene (CAS NO.274-09-9), its Synonyms are 1,3-Dioxaindan ; 1,3-Dioxindan ; 2H-1,3-Benzodioxole ; 3,4-Methylenedioxybenzene ; Benzene, 1,2-(methylenebis(oxy))- ; Benzodioxole ; Methylenedioxybenzene ; o-(Methylenedioxy)benzene ; 1,3-Benzodioxolane ; 1,3-Benzodioxole ; Benzene, 1,2-methylenedioxy- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29329970 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
