| Identification |
| Name: | Cyclohexanepropanoicacid, a-amino-, (aS)- |
| Synonyms: | Cyclohexanepropionic acid, a-amino-, L- (8CI);Cyclohexanepropanoicacid, a-amino-, (S)-;(S)-b-Cyclohexylalanine;3-Cyclohexyl-L-alanine;3-Cyclohexylalanine;L-3-Cyclohexylalanine;b-Cyclohexyl-L-alanine;(S)-2-Amino-3-cyclohexylpropionic acid;(S)-(+)-a-Aminocyclohexanepropionic acid;(2S)-2-Amino-3-cyclohexylpropanoic acid; |
| CAS: | 27527-05-5 |
| Molecular Formula: | C9H17NO2 |
| Molecular Weight: | 171.24 |
| InChI: | InChI=1/C9H17NO2/c1-7(9(11)12)10-8-5-3-2-4-6-8/h7-8,10H,2-6H2,1H3,(H,11,12)/t7-/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 322 °C |
| Flash Point: | 139.6°C |
| Boiling Point: | 307.1°Cat760mmHg |
| Density: | 1.075g/cm3 |
| Refractive index: | 1.489 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
The chemical synonyms of L-cyclohexylalanine (27527-05-5) are (S)-Cyclohexylalanine ; 3-Cyclohexyl-l-alanine hydrochloride ; 3-Cyclohexyl-l-alanine hydrochloride salt ; 3-Cyclohexyl-l-alanine ; 2-Amino-3-cyclohexylpropanoic Acid.
The product of L-cyclohexylalanine (27527-05-5) must store at 0°C .
|
| Flash Point: | 139.6°C |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |