| Identification |
| Name: | Carbamo(dithioperox)imidicacid, 2-furanylmethyl ester, monohydrochloride (9CI) |
| Synonyms: | 2-Furanmethanesulfenicacid, thio-, anhydrosulfide with 2-thiopseudourea (8CI); Pseudourea, 2-thio-,anhydrosulfide with thio-2-furanmethanesulfenic acid, monohydrochloride (8CI);NSC 242005 |
| CAS: | 27657-05-2 |
| Molecular Formula: | C6H8 N2 O S2 . Cl H |
| Molecular Weight: | 188.2705 |
| InChI: | InChI=1/C6H8N2OS2/c7-6(8)11-10-4-5-2-1-3-9-5/h1-3H,4H2,(H3,7,8) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 141°C |
| Boiling Point: | 309.6°Cat760mmHg |
| Density: | 1.45g/cm3 |
| Refractive index: | 1.671 |
| Flash Point: | 141°C |
| Safety Data |
| |
 |
