Identification |
Name: | Tris(hydroxymethyl)phosphine |
Synonyms: | bis(hydroxymethyl)phosphanylmethanol;Methanol,phosphinidynetris-;TRIMETHYLOLPHOSPHINE;PHOSPHINIDYNETRISMETHANOL;METHANOL, PHOSPHINIDYNETRI-;METHANOL, PHOSPHINIDYNETRIS-;TRIS(METHANOL)-PHOSPHINE; |
CAS: | 2767-80-8 |
EINECS: | 220-445-6 |
Molecular Formula: | C3H9O3P |
Molecular Weight: | 124.08 |
InChI: | InChI=1/C3H9O3P/c4-1-7(2-5)3-6/h4-6H,1-3H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 2811 6.1/PG 3 |
Melting Point: | 48-56 °C(lit.) |
Flash Point: | >230 °F |
Boiling Point: | 111-113 °C2.5 mm Hg(lit.) |
Density: | g/cm3 |
Specification: | White crystalline powder Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Flash Point: | >230 °F |
Safety Data |
|
 |