| Identification |
| Name: | Benzene,methyl(phenylmethyl)- |
| Synonyms: | Methane,phenyltolyl- (6CI,7CI); Barrel Process Oil B 03; Benzyltoluene;Methyl(phenylmethyl)benzene; Monobenzyltoluene; Neo-SK Oil 1300;Phenyltolylmethane; Tolylphenylmethane |
| CAS: | 27776-01-8 |
| EINECS: | 248-654-8 |
| Molecular Formula: | C14H14 |
| Molecular Weight: | 182.26096 |
| InChI: | InChI=1S/C14H14/c1-12-7-5-6-10-14(12)11-13-8-3-2-4-9-13/h2-10H,11H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | -55 C |
| Flash Point: | 122.3°C |
| Boiling Point: | 279.6°C at 760 mmHg |
| Density: | 0.984g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.566 |
| Water Solubility: | Stability Stable. Combustible. Incompatible with strong oxidizing agents. Toxicology Skin, eye and respiratory irritant. Repeated skin contact may causeskin degreasing or dermatitis. |
| Solubility: | |
| Appearance: | colourless to light yellow liquid |
| Flash Point: | 122.3°C |
| Safety Data |
| |
 |
