| Identification | |
| Name: | (S)-(+)-1-Amino-2-propanol |
| Synonyms: | S-(+)-Isopropanolamine; (S)-1-amino-2-propanol; S-(+)-1-Amino-2-propanol |
| CAS: | 2799-17-9 |
| EINECS: | 220-533-4 |
| Molecular Formula: | C3H9NO |
| Molecular Weight: | 75.11 |
| InChI: | InChI=1/C3H9NO/c1-3(5)2-4/h3,5H,2,4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3259 |
| Density: | 0.954 |
| Refractive index: | 1.4465-1.4495 |
| Alpha: | 18 o (C=1.8, H2O) |
| Water Solubility: | soluble |
| Solubility: | Very soluble |
| Appearance: | Colorless liquid. |
| Packinggroup: | III |
| HS Code: | 29221980 |
| Sensitive: | Hygroscopic |
| Color: | LIQUID |
| Usage: | An intermediate in the synthesis of a variety of pharmaceutical drugs and is the very basic building block of the opioid, methadone. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
