| Identification |
| Name: | Octanoic acid, compd. with 2-aminoethanol (1:1) |
| Synonyms: | Octanoic acid, compd. with 2-aminoethanol (1:1);Caprylic acid, monoethanolamine salt;Monoethanolamine caprylate;Monoethanolamine octanoate;Octanoic acid, compound with 2-aminoethanol (1:1);octanoic acid - 2-aminoethanol (1:1) |
| CAS: | 28098-03-5 |
| EINECS: | 248-838-8 |
| Molecular Formula: | C10H23NO3 |
| Molecular Weight: | 205.2945 |
| InChI: | InChI=1/C8H16O2.C2H7NO/c1-2-3-4-5-6-7-8(9)10;3-1-2-4/h2-7H2,1H3,(H,9,10);4H,1-3H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 107.4°C |
| Boiling Point: | 239.3°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 107.4°C |
| Safety Data |
| |
 |
