| Identification | |
| Name: | 4(3H)-Pyrimidinone,6-methyl-2-(1-methylethyl)- |
| Synonyms: | 4(1H)-Pyrimidinone,2-isopropyl-6-methyl- (8CI); 4(1H)-Pyrimidinone, 6-methyl-2-(1-methylethyl)-(9CI); 4-Pyrimidinol, 2-isopropyl-6-methyl- (6CI,7CI);2-Isopropyl-4-methyl-6-hydroxypyrimidine; 2-Isopropyl-4-methyl-6-pyrimidinone;2-Isopropyl-4-methylpyrimidin-6-ol; 2-Isopropyl-6-methyl-4(3H)-pyrimidone;2-Isopropyl-6-methyl-4-hydroxypyrimidine; 2-Isopropyl-6-methyl-4-pyrimidinol;2-Isopropyl-6-methyl-4-pyrimidone; 4-Hydroxy-2-isopropyl-6-methylpyrimidine; G27550; IMHP; Pyrimidinol |
| CAS: | 2814-20-2 |
| EINECS: | 220-561-7 |
| Molecular Formula: | C8H12 N2 O |
| Molecular Weight: | 152.19 |
| InChI: | InChI=1/C8H12N2O/c1-5(2)8-9-6(3)4-7(11)10-8/h4-5H,1-3H3,(H,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 93.2°C |
| Boiling Point: | 230.5°Cat760mmHg |
| Density: | 1.11g/cm3 |
| Refractive index: | 1.545 |
| Specification: |
Wash thoroughly after handling. Remove contaminated clothing and wash before reuse. Avoid contact with eyes, skin, and clothing. Avoid ingestion and inhalation.Store in a cool, dry place. Keep container closed when not in use. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 93.2°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
