| Identification | |
| Name: | Benzene,chlorotrinitro- |
| Synonyms: | Chlorotrinitrobenzene;Trinitrochlorobenzene |
| CAS: | 28260-61-9 |
| EINECS: | 201-864-3 |
| Molecular Formula: | C6H2 Cl N3 O6 |
| Molecular Weight: | 247.56 |
| InChI: | InChI=1/C6H2ClN3O6/c7-3-1-2-4(8(11)12)6(10(15)16)5(3)9(13)14/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 207.4°C |
| Boiling Point: | 419.3°C at 760 mmHg |
| Density: | 1.808g/cm3 |
| Refractive index: | 1.664 |
| Specification: |
The extinguishing agent of Trinitrochlorobenzene is water. |
| Flash Point: | 207.4°C |
| Safety Data | |
 |
|
