| Identification |
| Name: | 2-Propenoic acid, 2-methyl-, polymer with butyl 2-methyl-2-propenoate and methyl 2-methyl-2-propenoate |
| Synonyms: | 2-Propenoic acid, 2-methyl-, polymer with butyl 2-methyl-2-propenoate and methyl 2-methyl-2-propenoate;Butyl methacrylate, methyl methacrylate, methacrylic acid polymer;methyl methacrylate/ but methacrylate/ methacrylic acid;methyl methacrylate/ n-BMA/ MAA copolymer;Elvacite 2614;Elvacite 2013 Acrylic Resin;Elvacite 2016;Elvacite 2721 |
| CAS: | 28262-63-7 |
| Molecular Formula: | C17H28O6 |
| Molecular Weight: | 328.40062 |
| InChI: | InChI=1S/C8H14O2.C5H8O2.C4H6O2/c1-4-5-6-10-8(9)7(2)3;1-4(2)5(6)7-3;1-3(2)4(5)6/h2,4-6H2,1,3H3;1H2,2-3H3;1H2,2H3,(H,5,6) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 50.6°C |
| Boiling Point: | 160°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 50.6°C |
| Safety Data |
| |
 |
