| Identification |
| Name: | Cuprate(3-),[(7S,8S)-3-carboxy-5-(carboxymethyl)-13-ethenyl-18-ethyl-17-formyl-7,8-dihydro-2,8,12-trimethyl-21H,23H-porphine-7-propanoato(5-)-kN21,kN22,kN23,kN24]-, sodium (1:3), (SP-4-2)- |
| Synonyms: | Copper,[dihydrogen21-carboxy-14-ethyl-13-formyl-4,8,18-trimethyl-20-oxo-9-vinyl-3-phorbinepropionato(2-)]-,trisodium salt (8CI);Cuprate(3-),[(7S,8S)-3-carboxy-5-(carboxymethyl)-13-ethenyl-18-ethyl-17-formyl-7,8-dihydro-2,8,12-trimethyl-21H,23H-porphine-7-propanoato(5-)-kN21,kN22,kN23,kN24]-, trisodium, (SP-4-2)-(9CI); |
| CAS: | 28302-36-5 |
| EINECS: | 248-950-7 |
| Molecular Formula: | C34H31CuN4Na3O6 |
| Molecular Weight: | 669.16266 |
| InChI: | InChI=1S/C34H34N4O7.Cu/c1-6-18-15(3)23-11-24-16(4)20(8-9-29(40)41)32(37-24)21(10-30(42)43)33-31(34(44)45)17(5)25(38-33)12-27-19(7-2)22(14-39)28(36-27)13-26(18)35-23;/h6,11-14,16,20H,1,7-10H2,2-5H3,(H5,35,36,37,38,39,40,41,42,43,44,45);/q;+2/p-5/t16-,20-;/m0./s1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 25kgs |
| Flash Point: | 431.6°C |
| Boiling Point: | 790°Cat760mmHg |
| Water Solubility: | Insoluble SOLVENT |
| Solubility: | Insoluble SOLVENT < soluble in organic solvents including ether, benzene, white oil |
| Appearance: | green to black powder |
| Specification: |
Sodium copper chlorophyllin (CAS NO.28302-36-5) is also called for Derifil ; Natural green 3 ; Derifil (TN) ; Chlorophyl Cu complex ; Sodium-copper chlorin e6 ; Copper sodium chlorophyllin ; Chlorophyllin-copper complex ; CCRIS 5196 ; Chlorophyllin copper sodium salt[Sp-4-2-(2s-trans)]-sodiu ; 7,17-Trimethyl-21h,23h-porphine-2-propanoato(5-)-n21,n22,n23,n24]-hydro-tri ; Cuprate(3-),[18-carboxy-20-(carboxymethyl)-8-ethenyl-13-ethyl-12-formyl-2,3-di and so on.
Keep Sodium copper chlorophyllin (CAS NO.28302-36-5) at the temperature of 2-8 °C.
|
| Flash Point: | 431.6°C |
| Storage Temperature: | 2-8°C |
| Safety Data |
| |
 |