| Identification | |
| Name: | DL-2-Aminobutyric acid |
| Synonyms: | Butyric acid, 2-amino-, DL- (8CI);Butyric acid,2-amino-, dl- (5CI);Butyric acid, a-amino- (3CI);alpha-Aminobutyric acid;2-Amino-n-butyric acid;2-Aminobutanoic acid;2-Aminobutyric acid;AABA;Butyrine;DL-2-Amino-n-butyricacid;DL-2-Aminobutanoic acid;DL-Butyrine;DL-Ethylglycine;DL-a-Amino-n-butyric acid;DL-a-Aminobutanoic acid;DL-a-Aminobutyric acid;Homoalanine;dl-a-Amino-n-butyricacid;a-Amino-n-butyric acid;a-Aminobutyric acid; |
| CAS: | 2835-81-6 |
| EINECS: | 220-616-5 |
| Molecular Formula: | C4H9NO2 |
| Molecular Weight: | 103.12 |
| InChI: | InChI=1/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.105 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.438 |
| Solubility: | Very soluble |
| Appearance: | Off-White Solid |
| Specification: |
? alpha-Aminobutyric acid , with CAS number of 2835-81-6, can be called 2-Aminobutyric acid ; DL-2-Amino-n-butyric acid ; DL-alpha-Amino-n-butyric acid ; DL-alpha-Amino-n-butyric acid (beta-form) . It is an?off-white solid,?used?as a?descriptor amino acid QSARs peptide. |
| HS Code: | 29224995 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | A descriptor amino acid QSARs peptide |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
