Identification |
Name: | 4-Methoxycinnamonitrile, mixture of cis- and trans isomers |
Synonyms: | 4-Methoxycinnamonitrile |
CAS: | 28446-68-6 |
EINECS: | 249-022-4 |
Molecular Formula: | C10H9NO |
Molecular Weight: | 159.18 |
InChI: | InChI=1/C10H9NO/c1-12-10-6-4-9(5-7-10)3-2-8-11/h2-7H,1H3/b3-2+ |
Molecular Structure: |
|
Properties |
Transport: | 3276 |
Melting Point: | 50-55°C |
Flash Point: | 131.6°C |
Density: | 1.095 |
Refractive index: | n20/D 1.6131(lit.) |
Appearance: | Clear yellow liquid after melting |
Packinggroup: | III |
Flash Point: | 131.6°C |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|