| Identification |
| Name: | 3,4-Epoxytetrahydrofuran |
| Synonyms: | Furan, 3,4-epoxytetrahydro-;NSC 196231;3,6-Dioxabicyclo[3.1.0]hexane; |
| CAS: | 285-69-8 |
| EINECS: | 206-006-1 |
| Molecular Formula: | C4H6O2 |
| Molecular Weight: | 86.09 |
| InChI: | InChI=1/C4H6O2/c1-3-4(6-3)2-5-1/h3-4H,1-2H2 |
| Molecular Structure: |
![(C4H6O2) Furan, 3,4-epoxytetrahydro-;NSC 196231;3,6-Dioxabicyclo[3.1.0]hexane;](https://img.guidechem.com/casimg/285-69-8.gif) |
| Properties |
| Density: | 1.237 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.445-1.449 |
| Water Solubility: | MODERATELY SOLUBLE |
| Solubility: | MODERATELY SOLUBLE in water |
| Appearance: | clear yellow to orange liquid |
| Packinggroup: | I; II; III |
| Storage Temperature: | 0-6°C |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
