| Identification | |
| Name: | Thiabendazole, hypophosphite salt (2-(4-Thiazolyl) benzimidazole, hypophosphite salt) |
| Synonyms: | Arbotect;Elmpro;Arbotect S;Arbotect 20-S;Storite Clear Liquid;Thiabendazole hypophosphite;2-(4-Thiazolyl)benzimidazole, hypophosphite salt;Benzimidazole, 2-(4-thiazolyl)-, monophosphinate;Phosphinic acid, compd. with 2-(4-thiazolyl)-1H-benzimidazole (1:1);60062-20-6;AC1L1XVG;C10H7N3S.HO2P;LS-33183;4-(1H-benzimidazol-2-yl)-1,3-thiazole; phosphenous acid;phosphenous acid, compd. with 2-(4-thiazolyl)-1H-benzimidazole (1:1);28558-32-9;70088-28-7 |
| CAS: | 28558-32-9 |
| Molecular Formula: | C10H7N3S |
| Molecular Weight: | 265.228181 |
| InChI: | InChI=1S/C10H7N3S.HO2P/c1-2-4-8-7(3-1)12-10(13-8)9-5-14-6-11-9;1-3-2/h1-6H,(H,12,13);(H,1,2) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 304-305 deg C |
| Flash Point: | 226.2°C |
| Boiling Point: | 446°Cat760mmHg |
| Density: | 1.406g/cm3 |
| Solubility: | Max solubility in water at pH 2.2: 3.84%; slightly sol in alcohols, esters, chlorinated hydrocarbons In n-heptane Slightly soluble in ethanol In water, 50 mg/L at 25 deg C |
| Flash Point: | 226.2°C |
| Color: | Colorless crystals White crystals Off-white powder White to practically white powder White to tan crystals |
| Safety Data | |
 |
|
