| Identification | |
| Name: | 2-Propanone,1-(2R)-2-piperidinyl- |
| Synonyms: | 2-Propanone,1-(2-piperidinyl)-, (R)-; Pelletierine (6CI,7CI); (-)-Pelletierine;(R)-(-)-Pelletierine; Pelletierine, (-)-; Punicine |
| CAS: | 2858-66-4 |
| EINECS: | 220-673-6 |
| Molecular Formula: | C8H15 N O |
| Molecular Weight: | 141.24 |
| InChI: | InChI=1/C8H15NO/c1-7(10)6-8-4-2-3-5-9-8/h8-9H,2-6H2,1H3/t8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 618.8°C |
| Boiling Point: | 643.8°Cat760mmHg |
| Density: | 1.426g/cm3 |
| Refractive index: | 1.438 |
| Specification: |
Pelletierine (CAS NO.2858-66-4) is an alkaloid obtained as a liquid from the root of the pomegranate, It can soluble in water, alcohol, and ether. |
| Flash Point: | 618.8°C |
| Safety Data | |
 |
|
