| Identification | |
| Name: | Oxcarbazepine |
| Synonyms: | Trileptal;GP 47680;5H-Dibenz(b,f)azepine-5-carboxamide, 10,11-dihydro-10-oxo-;Oxcarbazepine (USAN);Trileptal (TN);Oxcarbazepine [INN];Oxcarbazepina [INN-Spanish];10,11-Dihydro-10-oxo-5H-dibenz(b,f)azepine-5-carboxamide;Oxcarbazepinum [INN-Latin]; |
| CAS: | 28721-07-5 |
| EINECS: | 249-188-8 |
| Molecular Formula: | C15H12N2O2 |
| Molecular Weight: | 252.27 |
| InChI: | InChI=1/C15H12N2O2/c16-15(19)17-12-7-3-1-5-10(12)9-14(18)11-6-2-4-8-13(11)17/h1-8H,9H2,(H2,16,19) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 20kgs |
| Melting Point: | 218 - 224 C |
| Flash Point: | 230 |
| Boiling Point: | 457 |
| Density: | 1.329g/cm3 |
| Refractive index: | 1.661 |
| Solubility: | Appearance:White to off-white crystalline powder Transport Information:20kgs Hazard Symbols:UN NO. |
| Appearance: | White to off-white crystalline powder |
| Biological Activity: | Anticonvulsant; protects mice and rats against generalized tonic-clonic seizures induced by electroshock. Thought to act via inhibition of sodium channel activity. |
| Flash Point: | 230 |
| Color: | white |
| Usage: | The keto derivative of Carbamazepine. Used as an anticonvulsant |
| Safety Data | |
| Hazard Symbols | |
 |
|
