| Identification | |
| Name: | 1H-Perimidin-2-amine |
| Synonyms: | Perimidine,2-amino- (8CI); 2-Aminoperimidine |
| CAS: | 28832-64-6 |
| EINECS: | 249-264-0 |
| Molecular Formula: | C11H9 N3 |
| Molecular Weight: | 183.23 |
| InChI: | InChI=1S/C11H9N3/c12-11-13-8-5-1-3-7-4-2-6-9(14-11)10(7)8/h1-6H,(H3,12,13,14) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 208.8°C |
| Boiling Point: | 421.7°Cat760mmHg |
| Density: | 1.4g/cm3 |
| Specification: |
Aminoperimidine , its cas register number is 28832-64-6. It also can be called 2-Aminoperimidine ; and 2,3-Dihydro-2-imino-1H-perimidine . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 208.8°C |
| Safety Data | |
 |
|
