Identification |
Name: | L-Cysteine,N-(1-oxopropyl)- |
Synonyms: | Cysteine,N-propionyl- (7CI); Cysteine, N-propionyl-, L- (8CI); N-(1-Oxopropyl)cysteine;N-Propionyl-L-cysteine; N-Propionylcysteine |
CAS: | 2885-79-2 |
Molecular Formula: | C6H11 N O3 S |
Molecular Weight: | 177.2214 |
InChI: | InChI=1S/C6H11NO3S/c1-2-5(8)7-4(3-11)6(9)10/h4,11H,2-3H2,1H3,(H,7,8)(H,9,10)/t4-/m0/s1 |
Molecular Structure: |
 |
Properties |
Flash Point: | 200.1°C |
Boiling Point: | 407.2°Cat760mmHg |
Density: | 1.243g/cm3 |
Flash Point: | 200.1°C |
Usage: | It is used as a reducing agent for hair in permanent waves. It does not damage the hair (as thioglycolic acid does); it is nontoxic, and does not harm the eyes or the mucous membranes. |
Safety Data |
|
 |