| Identification | |
| Name: | 3,4-Dihydroxy-3-cyclobutene-1,2-dione |
| Synonyms: | Squaric acid |
| CAS: | 2892-51-5 |
| EINECS: | 220-761-4 |
| Molecular Formula: | C4H2O4 |
| Molecular Weight: | 114.06 |
| InChI: | InChI=1/C4H2O4/c5-1-2(6)4(8)3(1)7/h5-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 2.415 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.629 |
| Solubility: | 20 (g/l) AUTOIGNITION |
| Appearance: | white crystalline powder |
| Packinggroup: | II |
| HS Code: | 29144090 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Squaric acid used as intermediate for squaraine dyes and heterocycles. Product Data Sheet |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
