| Identification | |
| Name: | 2,3-Dichlorobenzoyl Chloride |
| Synonyms: | 2,3-Dichloro benzoic acid |
| CAS: | 2905-60-4 |
| EINECS: | 220-811-5 |
| Molecular Formula: | C7H3Cl3O |
| Molecular Weight: | 209.46 |
| InChI: | InChI=1/C7H3Cl3O/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3261 |
| Density: | 14014 |
| Appearance: | white powder |
| Specification: |
?2,3-Dichlorobenzoyl Chloride , its cas register number 2905-60-4. It also can be called? 2,3-Dichlorobenzoyl chloride ; Benzoyl chloride, 2,3-dichloro- ; and HSDB 5901 . |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
