| Identification |
| Name: | myristic acid, monoester with propane-1,2-diol |
| Synonyms: | myristic acid, monoester with propane-1,2-diol;PROPYLENE GLYCOL MYRISTATE;Propylene glycol monomyristate;Tetradecanoic acid, monoester with 1,2-propanediol;propylene glycol myristate,propylene glycol monomyristate |
| CAS: | 29059-24-3 |
| EINECS: | 249-395-3 |
| Molecular Formula: | C17H34O3 |
| Molecular Weight: | 286.45006 |
| InChI: | InChI=1/C17H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-17(19)20-15-16(2)18/h16,18H,3-15H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 149.1°C |
| Boiling Point: | 392.2°C at 760 mmHg |
| Density: | 0.922g/cm3 |
| Refractive index: | 1.453 |
| Flash Point: | 149.1°C |
| Safety Data |
| |
 |
