| Identification | |
| Name: | Heptanone |
| Synonyms: | Heptanone |
| CAS: | 29299-43-2 |
| Molecular Formula: | C7H14O |
| Molecular Weight: | 114.18546 |
| InChI: | InChI=1S/C7H14O/c1-3-4-5-6-7(2)8/h3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -35.5 deg C |
| Flash Point: | 35°C |
| Boiling Point: | 151.5 deg C at 760 mm Hg; 111 deg C at 21 mm Hg |
| Density: | 0.807g/cm3 |
| Solubility: | Soluble in alcohol and ether 0.43% (by wt) in water Miscible with organic solvents In water, 4.28X10+3 mg/L at 25 deg C |
| Flash Point: | 35°C |
| Color: | Colorless to white liquid |
| Safety Data | |
 |
|
