| Identification | |
| Name: | Ciclopirox |
| Synonyms: | 2(1H)-Pyridone,6-cyclohexyl-1-hydroxy-4-methyl- (8CI);2(1H)-Pyridinone,6-cyclohexyl-1-hydroxy-4-methyl-;HOE 296b;Penlac; |
| CAS: | 29342-05-0 |
| EINECS: | 249-577-2 |
| Molecular Formula: | C12H17NO2 |
| Molecular Weight: | 207.26888 |
| InChI: | InChI=1S/C12H17NO2/c1-9-7-11(13(15)12(14)8-9)10-5-3-2-4-6-10/h7-8,10,15H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 144 oC |
| Density: | 1.193 g/cm3 |
| Refractive index: | 1.582 |
| Water Solubility: | soluble in methanol, ethanol or chloroform |
| Solubility: | soluble in methanol, ethanol or chloroform |
| Appearance: | white or light-yellow powder |
| Specification: |
?Ciclopirox (CAS NO.29342-05-0)?is also called?6-Cyclohexyl-1-hydroxy-4-methyl-1H-pyridin-2-one ; 6-Cyclohexyl-1-hydroxy-4-methyl-2[1H]-pyridinone ; Brumixol ; Cidochem .?Ciclopirox (CAS NO.29342-05-0) is odorless and bitter taste.? It is soluble in methanol, ethanol or chloroform, slightly soluble in DMF or water, slightly soluble in ethyl ether. |
| Storage Temperature: | Store in original container in a cool dark place. |
| Usage: | Broad spectrum antimycotic agent with some antibacterial activity |
| Safety Data | |
 |
|
