Identification |
Name: | Guanosine, 6-seleno- |
Synonyms: | 9H-Purin-6(1H)-one,2-amino-9-b-D-ribofuranosyl-6-seleno- (8CI);2-Amino-6-selenoxo-9-(b-D-ribofuranosyl)purine; 6-Selenoguanine riboside; 6-Selenoguanosine; NSC137679 |
CAS: | 29411-74-3 |
Molecular Formula: | C10H13 N5 O4 Se |
Molecular Weight: | 346.24 |
InChI: | InChI=1/C10H12N5O4Se/c11-10-13-7-4(8(20)14-10)12-2-15(7)9-6(18)5(17)3(1-16)19-9/h2-3,5-6,9,16-18H,1H2,(H2,11,13,14)/t3-,5-,6-,9-/m1/s1 |
Molecular Structure: |
|
Properties |
Transport: | UN 3283 6.1/PG 3 |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | g/cm3 |
Specification: |
6-Selenoguanosine ,its CAS NO. is 29411-74-3,the synonyms is 9H-Purine-6(1H)-one, 2-amino-9-beta-D-ribofuranosyl-6-seleno- ; NSC 137679 ; 9H-Purin-6(1H)-one, 2-amino-9-beta-D-ribofuranosyl-6-seleno- ; Guanosine, 6-seleno- (9CI) .
|
Report: |
Selenium and its compounds are on the Community Right-To-Know List.
|
Flash Point: | °C |
Storage Temperature: | −20°C |
Safety Data |
|
|