| Identification | |
| Name: | Carbamimidic chloride,monohydrochloride (9CI) |
| Synonyms: | Formamidine,1-chloro-, monohydrochloride (8CI);Chloroformamidine hydrochloride |
| CAS: | 29671-92-9 |
| EINECS: | 249-765-4 |
| Molecular Formula: | CH3 Cl N2 . Cl H |
| Molecular Weight: | 102.95 |
| InChI: | InChI=1/CH3ClN2.ClH/c2-1(3)4;/h(H3,3,4);1H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.55g/cm3 |
| Refractive index: | 1.529 |
| Specification: |
Chloroformamidinium chloride with cas registry number of 29671-92-9 is also known as Chloroformamidine HCl ; Chloroformamide hydrochloride . |
| Safety Data | |
 |
|
