| Identification | |
| Name: | 2,4(1H,3H)-Pyrimidinedione,1-(2-deoxy-a-D-erythro-pentofuranosyl)-5-fluoro- |
| Synonyms: | Uracil,1-(2-deoxy-a-D-erythro-pentofuranosyl)-5-fluoro-(7CI,8CI); Uracil, 1-(2-deoxy-a-D-ribofuranosyl)-5-fluoro- (6CI); 2'-Deoxy-a-D-ribofuranosyl-5-fluorouracil; NSC 66259; a-5-Fluoro-2'-deoxyuridine |
| CAS: | 2968-28-7 |
| Molecular Formula: | C9H11 F N2 O5 |
| Molecular Weight: | 246.1924 |
| InChI: | InChI=1S/C9H11FN2O5/c10-4-2-12(9(16)11-8(4)15)7-1-5(14)6(3-13)17-7/h2,5-7,13-14H,1,3H2,(H,11,15,16) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 150-151 deg C |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.64g/cm3 |
| Solubility: | 1 g in about 4.5 ml isopropanol, about 7.5 ml methanol, about 12 ml alcohol, about 27 ml acetone; insol in chloroform, ether, and benzene In water, 1.2X10+4 mg/L at 25 deg C (est) |
| Flash Point: | °C |
| Color: | Crystals from butyl acetate WHITE TO OFF-WHITE SOLID |
| Safety Data | |
 |
|
