| Identification | |
| Name: | Ethyl 4-bromobutyrate |
| Synonyms: | Butyricacid, 4-bromo-, ethyl ester (6CI,7CI,8CI);1-Bromo-3-(carboethoxy)propane;3-(Ethoxycarbonyl)propylbromide;4-Bromobutanoic acid ethyl ester;4-Bromobutyric acid ethyl ester;Ethyl 4-bromobutanoate;Ethyl g-bromobutyrate;Butanoic acid, 4-bromo-, ethyl ester;g-Bromobutyric acid ethyl ester; |
| CAS: | 2969-81-5 |
| EINECS: | 221-005-6 |
| Molecular Formula: | C6H11BrO2 |
| Molecular Weight: | 195.05 |
| InChI: | InChI=1/C6H11BrO2/c1-2-9-6(8)4-3-5-7/h2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2929 |
| Density: | 1.363 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4549-1.4569 |
| Water Solubility: | immiscible |
| Solubility: | immiscible |
| Appearance: | slightly yellow liquid |
| Specification: |
?Ethyl 4-bromobutyrate (CAS NO.2969-81-5), its Synonyms are Butanoic acid, 4-bromo-, ethyl ester (9CI) ; 4-Bromobutanoic acid, ethyl ester ; Ethyl gamma-bromobutyrate . It is clear colorless to yellow liquid. |
| Packinggroup: | I; II |
| HS Code: | 29159080 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
