| Identification | |
| Name: | 5-Bromovanillin |
| Synonyms: | 3-bromo-4-hydroxy-5-methoxy-benzaldehyde;Vanillin, 5-bromo-;Benzaldehyde, 3-bromo-4-hydroxy-5-methoxy-;5-Bromo vanillin;5-Bromovanillin 97%;5-Bromo-4-hydroxy-3-methoxybenzaldehyde;3-bromo-4-hydroxy-5-methoxybenzaldehyde; |
| CAS: | 2973-76-4 |
| EINECS: | 221-016-6 |
| Molecular Formula: | C8H7BrO3 |
| Molecular Weight: | 231.04 |
| InChI: | InChI=1/C8H7BrO3/c1-12-7-3-5(4-10)2-6(9)8(7)11/h2-4,11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.653 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.62 |
| Appearance: | light brown crystalline powder |
| Specification: |
5-Bromovanillin , its cas register number is 2973-76-4. It also can be called Vanillin, 5-bromo- ; Benzaldehyde, 3-bromo-4-hydroxy-5-methoxy- ; 3-Bromo-4-hydroxy-5-methoxybenzaldehyde .It is a light brown crystalline powder. |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Air & Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
