| Identification |
| Name: | 2H-Tetrazolium,3,3'-[1,1'-biphenyl]-4,4'-diylbis[2,5-diphenyl-, chloride (1:2) |
| Synonyms: | 2H-Tetrazolium,3,3'-(4,4'-biphenylylene)bis[2,5-diphenyl-, dichloride (8CI);2H-Tetrazolium,3,3'-[1,1'-biphenyl]-4,4'-diylbis[2,5-diphenyl-, dichloride (9CI);3,3'-(4,4'-Biphenylylene)bis[2,5-diphenyl-2H-tetrazolium chloride] (6CI);2,2'-(p-Diphenylene)bis(3,5-diphenyl)ditetrazolium chloride;3,3'-(4,4'-Biphenylene)bis[2,5-diphenyltetrazolium chloride];NSC 27621;NTC;Neo-T;Neotetrazolium;Neotetrazolium blue;Neotetrazolium chloride;TP; |
| CAS: | 298-95-3 |
| EINECS: | 206-070-0 |
| Molecular Formula: | C38H28Cl2N8 |
| Molecular Weight: | 669.6044 |
| InChI: | InChI=1S/C38H30N8.2ClH/c1-5-13-33(14-6-1)41-29-43(35-17-9-3-10-18-35)45(39-41)37-25-21-31(22-26-37)32-23-27-38(28-24-32)46-40-42(34-15-7-2-8-16-34)30-44(46)36-19-11-4-12-20-36;;/h1-30H;2*1H/q+4;;/p-2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | methanol: 50 mg/mL, clear |
| Solubility: | methanol: 50 mg/mL, clear |
| Appearance: | ochre-yellow to yellow-brown powder |
| Specification: |
The Neotetrazolium chloride with its cas register number is 298-95-3. It also can be called as 3,3'-(4,4'-Biphenylene)bis(2,5-diphenyl-2H-tetrazolium chloride) and the Systematic name about this chemical is 3,3'-biphenyl-4,4'-diylbis(2,5-diphenyl-2H-tetrazol-3-ium) dichloride. It belongs to the following product categories, such as Tetrazolium Salts and Tetrazolium Salts & Formazans. This chemical is harmful if swallowed. When you are using it, wear suitable protective clothing and avoid contact with skin and eyes.
You can still convert the following datas into molecular structure:
(1)SMILES: [Cl-].[Cl-].n6[n+](c5ccc(c4ccc([n+]2nc(nn2c1ccccc1)c3ccccc3)cc4)cc5)n(nc6c7ccccc7)c8ccccc8
(2)InChI: InChI=1/C38H28N8.2ClH/c1-5-13-31(14-6-1)37-39-43(33-17-9-3-10-18-33)45(41-37)35-25-21-29(22-26-35)30-23-27-36(28-24-30)46-42-38(32-15-7-2-8-16-32)40-44(46)34-19-11-4-12-20-34;;/h1-28H;2*1H/q+2;;/p-2
(3)InChIKey: WYFYSTBFFDOVJW-NUQVWONBAR
(4)Std. InChI: InChI=1S/C38H28N8.2ClH/c1-5-13-31(14-6-1)37-39-43(33-17-9-3-10-18-33)45(41-37)35-25-21-29(22-26-35)30-23-27-36(28-24-30)46-42-38(32-15-7-2-8-16-32)40-44(46)34-19-11-4-12-20-34;;/h1-28H;2*1H/q+2;;/p-2
(5)Std. InChIKey: WYFYSTBFFDOVJW-UHFFFAOYSA-L
|
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Usage: | Staining of microorganisms and plant and animal tissues. |
| Safety Data |
| |
 |