| Identification | |
| Name: | malic acid, compound with 2,2',2''-nitrilotriethanol |
| Synonyms: | Butanedioic acid, 2-hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol) (1:?);Butanedioic acid, hydroxy-, compd. with 2,2',2''-nitrilotris(ethanol);Malic acid, compound with 2,2',2''-nitrilotriethanol;2-hydroxybutanedioic acid - 2,2',2''-nitrilotriethanol (1:1) |
| CAS: | 29868-02-8 |
| EINECS: | 249-904-9 |
| Molecular Formula: | C10H21NO8 |
| Molecular Weight: | 283.2756 |
| InChI: | InChI=1/C6H15NO3.C4H6O5/c8-4-1-7(2-5-9)3-6-10;5-2(4(8)9)1-3(6)7/h8-10H,1-6H2;2,5H,1H2,(H,6,7)(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185°C |
| Boiling Point: | 335.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 185°C |
| Safety Data | |
 |
|
