| Identification | |
| Name: | 5-bromo-5-nitro-1,3-dioxane |
| Synonyms: | 5-bromo-5-nitro-1,3-dioxolane; BND; BRONIDOX; BRONIDOX L; 3-Dioxane,5-bromo-5-nitro-1; 5-Brom-5-nitro-1,3-dioxan; 5-bromo-5-nitro-3-dioxane; 5-bromo-5-nitro-m-dioxan; 5-Bromo-5-Nitro-1,3-Dioxame |
| CAS: | 30007-47-7 |
| EINECS: | 250-001-7 |
| Molecular Formula: | C4H6BrNO4 |
| Molecular Weight: | 212 |
| InChI: | InChI=1/C4H6BrNO4/c5-4(6(7)8)1-9-3-10-2-4/h1-3H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kgs |
| Density: | 1.83 g/cm3 |
| Refractive index: | 1.532 |
| Appearance: | White crystalline powder |
| Specification: |
5-Bromo-5-nitro-1,3-dioxane (CAS NO.30007-47-7) can be also called as Bronidox; Bronidox l ; 3-Dioxane,5-bromo-5-nitro-1 ; 5-Brom-5-nitro-1,3-dioxan ; 5-bromo-5-nitro-3-dioxane ; 5-Bromo-5-Nitro-1,3-Dioxame and so on. 5-Bromo-5-nitro-1,3-dioxane (CAS NO.30007-47-7) is commonly in the form of white crystal powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
