Identification |
Name: | 2-Oxiraneoctanoic acid,3-[(3-pentyl-2-oxiranyl)methyl]- |
Synonyms: | Octadecanoicacid, 9,10:12,13-diepoxy- (6CI,7CI,8CI); Oxiraneoctanoic acid,3-[(3-pentyloxiranyl)methyl]- (9CI); 9,10:12,13-Diepoxyoctadecanoic acid;9,12-Diepoxyoctadecanoic acid; Diepoxylinoleic acid; Linoleic acid dioxide; NSC3581 |
CAS: | 3012-69-9 |
Molecular Formula: | C18H32 O4 |
Molecular Weight: | 312.50 |
InChI: | InChI=1/C18H32O4/c1-2-3-7-10-14-16(21-14)13-17-15(22-17)11-8-5-4-6-9-12-18(19)20/h14-17H,2-13H2,1H3,(H,19,20) |
Molecular Structure: |
 |
Properties |
Flash Point: | 153.1°C |
Boiling Point: | 447.9°Cat760mmHg |
Density: | 1.039g/cm3 |
Refractive index: | 1.485 |
Report: |
9,10:12,13-Diepoxyoctadecanoic acid (CAS NO.3012-69-9) was reported in JNCIAM Journal of the National Cancer Institute.
|
Flash Point: | 153.1°C |
Safety Data |
|
 |