| Identification | |
| Name: | Pentamethyldiethylenetriamine |
| Synonyms: | 1,1,4,7,7-Pentamethyldiethylenetriamine-; Bis(2-dimethylaminoethyl)methylamine; N,N,N,N,-pentamethyldiethylenetriamine (Am-1) PMDETA; PMDETA; PMDTA; N,N,N',N'',N''-PENTAMETHYLDIETHYLENETRIAMINE; N,N,N',N',N''-PENTAMETHYLDIETHYLENETRIAMINE; n-[2-(dimethylamino)ethyl]-n,n',n'-trimethyl-1,2-ethanediamine; 1,1,4,7,7-pentamethyl-diethylenetriamin; 2,5,8-trimethyl-2,5,8-triazanonane; N,N,N',N',N"-Pentamethyldiethylenetriamine |
| CAS: | 3030-47-5 |
| EINECS: | 221-201-1 |
| Molecular Formula: | C9H23N3 |
| Molecular Weight: | 173.29902 |
| InChI: | InChI=1S/C9H23N3/c1-10(2)6-8-12(5)9-7-11(3)4/h6-9H2,1-5H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2734 |
| Density: | 0.827 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents, strong acids. |
| Refractive index: | 1.442 |
| Water Solubility: | miscible |
| Solubility: | miscible |
| Appearance: | clear to yellowish liquid |
| Specification: |
Pentamethyldiethylenetriamine , its CAS NO. is 3030-47-5, the synonyms are N-[2-(Dimethylamino)ethyl]-N,N',N'-trimethyl-1,2-ethanediamine ; Bis(2-dimethylaminoethyl)methylamine ; N,N,N',N',N''-Pentamethyldiethylenetriamine ; PMDTA . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29212900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
