| Identification |
| Name: | 1H-Imidazo[4,5-b]pyridine,1-(methyl-d3)-2-nitro-6-phenyl- (9CI) |
| Synonyms: | 1-Methyl-2-nitro-6-phenylimidazo[4,5-B]pyridine-d3 |
| CAS: | 303173-40-2 |
| Molecular Formula: | C13H7 D3 N4 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C13H10N4O2/c1-16-11-7-10(9-5-3-2-4-6-9)8-14-12(11)15-13(16)17(18)19/h2-8H,1H3/i1D3 |
| Molecular Structure: |
![(C13H7D3N4O2) 1-Methyl-2-nitro-6-phenylimidazo[4,5-B]pyridine-d3](https://img1.guidechem.com/chem/e/dict/11/303173-40-2.jpg) |
| Properties |
| Flash Point: | 258.989°C |
| Boiling Point: | 504.626°C at 760 mmHg |
| Density: | 1.421g/cm3 |
| Refractive index: | 1.705 |
| Flash Point: | 258.989°C |
| Usage: | Shows potent mutagenic activity in the reversion assay of Salmonella typhimurium |
| Safety Data |
| |
 |
