Identification |
Name: | 2-Naphthalenecarboxylicacid, 3-hydroxy-, 2-[(3,4-dihydroxyphenyl)methylene]hydrazide |
Synonyms: | 2-Naphthalenecarboxylicacid, 3-hydroxy-, [(3,4-dihydroxyphenyl)methylene]hydrazide (9CI); Dynasore |
CAS: | 304448-55-3 |
Molecular Formula: | C18H14 N2 O4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C18H14N2O4/c21-15-6-5-11(7-17(15)23)10-19-20-18(24)14-8-12-3-1-2-4-13(12)9-16(14)22/h1-10,21-23H,(H,20,24)/b19-10+ |
Molecular Structure: |
|
Properties |
Transport: | UN 3077 9/PG 3 |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | 1.36g/cm3 |
Refractive index: | 1.665 |
Biological Activity: | Non-competitive inhibitor of dynamin 1, dynamin 2 and mitochondrial dynamin (Drp1) GTPase activity. Does not inhibit other small GTPases. Blocks endocytic pathways dependent on dynamin and inhibits cell spreading and migration of BSC1 cells. |
Flash Point: | °C |
Storage Temperature: | −20°C |
Safety Data |
Hazard Symbols |
N: Dangerous for the environment
|
|
|