| Identification |
| Name: | 2-Butenenitrile,2-methyl-, (2E)- |
| Synonyms: | 2-Butenenitrile,2-methyl-, (E)-; Crotononitrile, 2-methyl-, (E)- (8CI); Tiglonitrile (6CI,7CI);(E)-2-Methyl-2-butenenitrile; Tubulonitrile; trans-2-Methyl-2-butenenitrile;trans-2-Methyl-2-butenonitrile |
| CAS: | 30574-97-1 |
| EINECS: | 250-247-5 |
| Molecular Formula: | C5H7 N |
| Molecular Weight: | 81.11578 |
| InChI: | InChI=1S/C5H7N/c1-3-5(2)4-6/h3H,1-2H3/b5-3+ |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 27.6°C |
| Boiling Point: | 123.6°Cat760mmHg |
| Density: | 0.828g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.425 |
| Water Solubility: | Stability Stable. Combustible. Incompatible with strong oxidizing agents. Toxicology No toxicological data available. Toxicity data (The meaning of any toxicolog |
| Solubility: | |
| Flash Point: | 27.6°C |
| Safety Data |
| |
 |
