| Identification |
| Name: | Benzonitrile, 4-iodo- |
| Synonyms: | Benzonitrile,p-iodo- (6CI,7CI,8CI);1-Cyano-4-iodobenzene;4-Cyano-1-iodobenzene;4-Cyanoiodobenzene;4-Cyanophenyl iodide;4-Iodocyanobenzene;NSC 87894;p-Cyanoiodobenzene;p-Cyanophenyl iodide;p-Iodobenzonitrile; |
| CAS: | 3058-39-7 |
| Molecular Formula: | C7H4IN |
| Molecular Weight: | 229.02 |
| InChI: | InChI=1/C7H4IN/c8-7-3-1-6(5-9)2-4-7/h1-4H |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3439 |
| Density: | 1.91 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.66 |
| Water Solubility: | Freely Soluble in Alcohol & Ether. Insoluble in Water. |
| Solubility: | Freely Soluble in Alcohol & Ether. Insoluble in Water. |
| Appearance: | Pale yellow to off-white Powder |
| Packinggroup: | III |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
