| Identification | |
| Name: | Urea,N'-(4-bromophenyl)-N-methoxy-N-methyl- |
| Synonyms: | Urea,3-(p-bromophenyl)-1-methoxy-1-methyl- (7CI,8CI);1-(p-Bromophenyl)-3-methoxy-3-methylurea; 1-Methoxy-1-methyl-3-(4-bromophenyl)urea;1-Methoxy-1-methyl-3-(p-bromophenyl)urea;3-(4-Bromophenyl)-1-methyl-1-methoxyurea;3-(p-Bromophenyl)-1-methoxy-1-methylurea;3-(p-Bromophenyl)-1-methyl-1-methoxyurea; C 3126; Metbromuron; Metobromuron;Monobromuron; N-(4-Bromophenyl)-N'-methoxy-N'-methylurea;N-(4-Bromophenyl)-N'-methyl-N'-methoxyurea;N-(p-Bromophenyl)-N'-methyl-N'-methoxyurea; Patoran |
| CAS: | 3060-89-7 |
| EINECS: | 221-301-5 |
| Molecular Formula: | C9H11 Br N2 O2 |
| Molecular Weight: | 259.0998 |
| InChI: | InChI=1/C9H11BrN2O2/c1-12(14-2)9(13)11-8-5-3-7(10)4-6-8/h3-6H,1-2H3,(H,11,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1648 3 |
| Melting Point: | 95.5-96 ºC |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.534 g/cm3 |
| Stability: | Very stable in neutral, weakly acidic and weakly alkaline media; hydrolyzed by strong acids and bases; the formulated product is stable up to 50 C for at least 2 yr. |
| Refractive index: | 1.607 |
| Appearance: | White to brown powder |
| Specification: |
The chemical synonyms of 3-(4-Bromophenyl)-1-methoxy-1-methylurea (CAS NO.3060-89-7) are 3-(4-Bromphenyl)-1-methoxyharnstoff ; 3-(p-bromophenyl)-1-methoxy-1-methyl-ure ; C 3126 ; c-3126 ; Metbromuron ; Monobromuron ; n-(4-Bromophenyl)-n’-methyl-n’-methoxy-harnstoff ; n’-(4-bromophenyl)-n-methoxy-n-methyl-ure . It can be used as herbicide. |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | °C |
| Storage Temperature: | APPROX 4°C |
| Color: | CRYSTALS FROM CYCLOHEXANE WHITE CRYSTALS |
| Usage: | Used on beans, soybeans, tomatoes, tobacco, potatoes, flax, and sunflowers. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
F: Flammable
|
 |
|
