| Identification | |
| Name: | 2-Propenenitrile,2-(acetyloxy)- |
| Synonyms: | Acrylonitrile,2-hydroxy-, acetate (7CI); Acrylonitrile, 2-hydroxy-, acetate (ester) (8CI);1-Cyanovinyl acetate; 2-Acetoxyacrylonitrile; Acetic acid, 1-cyanovinyl ester; a-Acetoxyacrylonitrile; a-Cyanovinyl acetate |
| CAS: | 3061-65-2 |
| EINECS: | 221-303-6 |
| Molecular Formula: | C5H5 N O2 |
| Molecular Weight: | 111.11 |
| InChI: | InChI=1/C5H5NO2/c1-4(3-6)8-5(2)7/h1H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3276 6.1/PG 2 |
| Flash Point: | 63.9°C |
| Boiling Point: | 173.2°Cat760mmHg |
| Density: | 1.08g/cm3 |
| Refractive index: | n20/D 1.426(lit.) |
| Specification: |
2-Acetoxyacrylonitrile ,its cas register number is 3061-65-2. It also can be called 1-Kyanvinylester kyseliny octove ; 2-Propenenitrile, 2-(acetyloxy)- ; and 1-Cyanovinyl acetate . |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. |
| Packinggroup: | II |
| Flash Point: | 63.9°C |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
