| Identification | |
| Name: | Benzamide,5-amino-N-butyl-2-(2-propyn-1-yloxy)- |
| Synonyms: | Benzamide,5-amino-N-butyl-2-(2-propynyloxy)- (8CI,9CI); MY 41-6; Parsal; Parsalmide |
| CAS: | 30653-83-9 |
| EINECS: | 250-274-2 |
| Molecular Formula: | C14H18 N2 O2 |
| Molecular Weight: | 246.34 |
| InChI: | InChI=1/C14H18N2O2/c1-3-5-8-16-14(17)12-10-11(15)6-7-13(12)18-9-4-2/h2,6-7,10H,3,5,8-9,15H2,1H3,(H,16,17) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 210.3°C |
| Boiling Point: | 424°Cat760mmHg |
| Density: | 1.107g/cm3 |
| Refractive index: | 1.558 |
| Specification: |
5-Amino-n-butyl-2-propargyloxy benzamide (CAS NO.30653-83-9) is also called Parsalmide ; 5-Amino-N-butyl-2-(2-propynyloxy)benzamide ; MY-41-6 ; Parsal . 5-Amino-n-butyl-2-propargyloxy benzamide (CAS NO.30653-83-9) is high toxic. It is flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 210.3°C |
| Safety Data | |
 |
|
