| Identification | |
| Name: | L-Glutamine,N-ethyl- |
| Synonyms: | Glutamine,N-ethyl-, L- (6CI,7CI,8CI);NSC 21308;Ng-Ethyl-L-glutamine;Suntheanine;Theanin;Theanine;L-Theanine (Ngamma-ethyl-L-glutamine); |
| CAS: | 3081-61-6 |
| EINECS: | 221-379-0 |
| Molecular Formula: | C7H14N2O3 |
| Molecular Weight: | 174.19766 |
| InChI: | InChI=1S/C7H14N2O3/c1-2-9-6(10)4-3-5(8)7(11)12/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.171 g/cm3 |
| Water Solubility: | (1.0g/20ml H2O) Clear Colorless |
| Solubility: | (1.0g/20ml H2O) Clear Colorless |
| Appearance: | White Crystalline Solid |
| Biological Activity: | Amino acid analog of glutamine and component of green tea. Shown to bind to AMPA, Kainate, NMDA and group I mGlu receptors. Displays neuroprotective effects in vivo . Promotes self-renewal of human embryonic stem cells (hESC). |
| Usage: | A non-protein amino acid mainly found naturally in the green tea plant. It may have activity in modulating the metabolism of cancer chemotherapeutics agents |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
