| Identification |
| Name: | D-Glucopyranuronicacid, methyl ester, 2,3,4-triacetate |
| Synonyms: | Glucopyranuronicacid, methyl ester, 2,3,4-triacetate (6CI,7CI) |
| CAS: | 3082-95-9 |
| Molecular Formula: | C13H18 O10 |
| Molecular Weight: | 334.276 |
| InChI: | InChI=1/C13H18O10/c1-5(14)20-8-9(21-6(2)15)11(22-7(3)16)13(19-4)23-10(8)12(17)18/h8-11,13H,1-4H3,(H,17,18)/t8-,9-,10-,11+,13?/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 154.3°C |
| Boiling Point: | 430.6°Cat760mmHg |
| Density: | 1.37g/cm3 |
| Refractive index: | 1.492 |
| Flash Point: | 154.3°C |
| Usage: | May contain a minor amount of the beta isomer |
| Safety Data |
| |
 |
