| Identification | |
| Name: | 2-Naphthalenemethanol,6-hydroxy- |
| Synonyms: | 6-(Hydroxymethyl)-2-naphthol;6-Hydroxymethyl-naphthalen-2-ol; |
| CAS: | 309752-65-6 |
| Molecular Formula: | C11H10O2 |
| Molecular Weight: | 174.20 |
| InChI: | InChI=1/C11H10O2/c12-7-8-1-2-10-6-11(13)4-3-9(10)5-8/h1-6,12-13H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.282 |
| Refractive index: | 1.699 |
| Specification: |
The 6-Hydroxy-2-naphthalenemethanol, with CAS registry number 309752-65-6, has the systematic name of 6-(hydroxymethyl)naphthalen-2-ol. Besides this, it is also called 2-naphthalenemethanol, 6-hydroxy-. And the chemical formula of this chemical is C11H10O2. Physical properties about this chemical are: (1)ACD/LogP: 1.53; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.53; (4)ACD/LogD (pH 7.4): 1.53; (5)ACD/BCF (pH 5.5): 8.55; (6)ACD/BCF (pH 7.4): 8.48; (7)ACD/KOC (pH 5.5): 161.7; (8)ACD/KOC (pH 7.4): 160.47; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 18.46 Å2; (13)Index of Refraction: 1.699; (14)Molar Refractivity: 52.42 cm3; (15)Molar Volume: 135.7 cm3; (16)Polarizability: 20.78×10-24cm3; (17)Surface Tension: 61.1 dyne/cm; (18)Enthalpy of Vaporization: 67.82 kJ/mol; (19)Vapour Pressure: 6.9E-07 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
