| Identification |
| Name: | 1-Propanethiol,3-(dimethoxymethylsilyl)- |
| Synonyms: | (3-Mercaptopropyl)dimethoxymethylsilane;(g-Mercaptopropyl)dimethoxymethylsilane;3-(Dimethoxymethylsilyl)-1-propanethiol;AY 43-062;Dimethoxy(3-mercaptopropyl)methylsilane;Dimethoxymercaptopropylmethylsilane;Dimethoxymethyl(3-mercaptopropyl)silane;KBE 802;KBM 802;KEM 802;Methyl(3-mercaptopropyl)dimethoxysilane;SiSiB PC2320; |
| CAS: | 31001-77-1 |
| EINECS: | 250-426-8 |
| Molecular Formula: | C6H16O2SSi |
| Molecular Weight: | 180.34 |
| InChI: | InChI=1/C6H16O2SSi/c1-7-6(8-2)10-5-3-4-9/h6,9H,3-5,10H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN2924 |
| Flash Point: | 199? |
| Density: | 1 |
| Refractive index: | 1.45 |
| Appearance: | Clear to straw liquid with unpleasant odor of sulfide |
| Packinggroup: | III |
| Flash Point: | 199? |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
