| Identification |
| Name: | 1H-Imidazole,2-[1-(2,6-dichlorophenoxy)ethyl]-4,5-dihydro- |
| CAS: | 31036-80-3 |
| Molecular Formula: | C11H12 Cl2 N2 O |
| Molecular Weight: | 259.13 |
| InChI: | InChI=1/C11H12Cl2N2O/c1-7(11-14-5-6-15-11)16-10-8(12)3-2-4-9(10)13/h2-4,7H,5-6H2,1H3,(H,14,15) |
| Molecular Structure: |
![(C11H12Cl2N2O) 2-Imidazoline,2-[1-(2,6-dichlorophenoxy)ethyl]- (8CI); (?à)-Lofexidine; Lofexidine; NIH 10868](https://img.guidechem.com/casimg/31036-80-3.gif) |
| Properties |
| Melting Point: | 127 |
| Flash Point: | 208.7°C |
| Boiling Point: | 421.5°Cat760mmHg |
| Density: | 1.39g/cm3 |
| Refractive index: | 1.61 |
| Solubility: | Insoluble |
| Flash Point: | 208.7°C |
| Storage Temperature: | Store in original container in a cool dark place. |
| Usage: | A short-acting anti-hypertensive, but more commonly used to alleviate physical symptoms of heroin and opiate withdrawal. |
| Safety Data |
| |
 |