| Identification |
| Name: | 2-Piperidinecarboxylicacid, (2S)- |
| Synonyms: | 2-Piperidinecarboxylicacid, (S)-;Pipecolic acid, (S)-(-)- (8CI);(-)-Pipecolic acid;(S)-(-)-2-Piperidinecarboxylic acid;(S)-(-)-Pipecolic acid;(S)-Pipecolinic acid;(S)-Piperidine-2-carboxylic acid;L-Pipecolic acid;L-Piperidine-2-carboxylic acid;NSC 93089; |
| CAS: | 3105-95-1 |
| EINECS: | 221-462-1 |
| Molecular Formula: | C6H11NO2 |
| Molecular Weight: | 129.16 |
| InChI: | InChI=1/C6H11NO2/c8-6(9)5-3-1-2-4-7-5/h5,7H,1-4H2,(H,8,9) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.125 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -27.5 o (C=5, H2O 24 oC) |
| Water Solubility: | soluble |
| Solubility: | Soluble in water |
| Appearance: | white to light yellow crystal powde |
| Storage Temperature: | Store at RT. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
