| Identification | |
| Name: | Ethyleneglycol monomethyl ether acrylate |
| Synonyms: | 2-Methoxyethyl acrylate, (Acrylic acid 2-methoxyethyl ester) |
| CAS: | 3121-61-7 |
| EINECS: | 221-499-3 |
| Molecular Formula: | C6H10O3 |
| Molecular Weight: | 130.14 |
| InChI: | InChI=1/C6H10O3/c1-3-6(7)9-5-4-8-2/h3H,1,4-5H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1992 |
| Melting Point: | -30°C |
| Density: | 1.012 |
| Stability: | No data. |
| Refractive index: | 1.426-1.43 |
| Solubility: | Soluble |
| Appearance: | Clear colorless liquid with a sharp musty odor. |
| Specification: |
Methyl cellosolve acrylate ,its CAS NO. is 3121-61-7,the synonyms is 2-Methoxy-ethanoacrylate ; 2-Methoxyethanol,acrylate ; 2-Propenoicacid,2-methoxyethylester ; Glycolmonomethyletheracrylate ; Methylcellosolveacrylate ; Sipomermca ; Acrylic acid 2-methoxyethyl ester ; 2-Methoxyethyl acrylate . |
| Report: |
Glycol ether compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | II |
| HS Code: | 29161290 |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
