| Identification |
| Name: | Benzamide,2-chloro-5-nitro-N-4-pyridinyl- |
| Synonyms: | T 0070907 |
| CAS: | 313516-66-4 |
| Molecular Formula: | C12H8 Cl N3 O3 |
| Molecular Weight: | 277.66 |
| InChI: | InChI=1/C12H8ClN3O3/c13-11-2-1-9(16(18)19)7-10(11)12(17)15-8-3-5-14-6-4-8/h1-7H,(H,14,15,17) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 184.6°C |
| Boiling Point: | 381.7°Cat760mmHg |
| Density: | 1.498g/cm3 |
| Refractive index: | 1.684 |
| Biological Activity: | Potent and selective PPAR γ antagonist (IC 50 = 1 nM). Displays > 800-fold selectivity for PPAR γ over PPAR α and PPAR δ . In vitro, blocks transcriptional activity of PPAR γ and inhibits rosiglitazone-induced adipogenesis. |
| Flash Point: | 184.6°C |
| Usage: | A cell-permeable chloro-nitro-benzamido compound that acts as a potent, specific, irreversible, and high-affinity antagonist of PPAR with a Ki of 1 nM. Displays >800-fold greater selectivity for PPAR over PPARa and PPARd (Ki = 0.85 and 1.8 , |
| Safety Data |
| |
 |
